C17H12BrClF3N3O — CID 44816586
5-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)triazole (PubChem CID 44816586) has the molecular formula C17H12BrClF3N3O and a molecular weight of 446.65 g/mol. Its IUPAC name is 5-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)triazole.
| Compound Name | 5-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)triazole |
|---|---|
| PubChem CID | 44816586 |
| Molecular Formula | C17H12BrClF3N3O |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 5-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]-4-(4-methoxyphenyl)triazole |
| SMILES | COc1ccc(-c2nnn(-c3ccc(C(F)(F)F)cc3Cl)c2CBr)cc1 |
| InChI | InChI=1S/C17H12BrClF3N3O/c1-26-12-5-2-10(3-6-12)16-15(9-18)25(24-23-16)14-7-4-11(8-13(14)19)17(20,21)22/h2-8H,9H2,1H3 |
| InChIKey | ZJAJVUZTXSCAEH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|