C15H15N3S — CID 44623037
2-(1-benzylimidazol-2-yl)-4,5-dimethyl-1,3-thiazole (PubChem CID 44623037) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(1-benzylimidazol-2-yl)-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-(1-benzylimidazol-2-yl)-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 44623037 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-(1-benzylimidazol-2-yl)-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(-c2nccn2Cc2ccccc2)sc1C |
| InChI | InChI=1S/C15H15N3S/c1-11-12(2)19-15(17-11)14-16-8-9-18(14)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3 |
| InChIKey | PTPODCWWEZJSLF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |