C17H16O7 — CID 44623678
methyl 1,3-diacetyloxy-6-deuterio-7-methoxynaphthalene-2-carboxylate (PubChem CID 44623678) has the molecular formula C17H16O7 and a molecular weight of 333.31 g/mol. Its IUPAC name is methyl 1,3-diacetyloxy-6-deuterio-7-methoxynaphthalene-2-carboxylate.
| Compound Name | methyl 1,3-diacetyloxy-6-deuterio-7-methoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 44623678 |
| Molecular Formula | C17H16O7 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | methyl 1,3-diacetyloxy-6-deuterio-7-methoxynaphthalene-2-carboxylate |
| SMILES | [2H]c1cc2cc(OC(C)=O)c(C(=O)OC)c(OC(C)=O)c2cc1OC |
| InChI | InChI=1S/C17H16O7/c1-9(18)23-14-7-11-5-6-12(21-3)8-13(11)16(24-10(2)19)15(14)17(20)22-4/h5-8H,1-4H3/i6D |
| InChIKey | DOMQWBWAEOQVFV-RAMDWTOOSA-N |
| XLogP | 2.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|