C17H12N2O5 — CID 44623778
1-(4-hydroxy-5-oxocyclohepta-1,3,6-trien-1-yl)-3-(2-oxochromen-3-yl)urea (PubChem CID 44623778) has the molecular formula C17H12N2O5 and a molecular weight of 324.29 g/mol. Its IUPAC name is 1-(4-hydroxy-5-oxocyclohepta-1,3,6-trien-1-yl)-3-(2-oxochromen-3-yl)urea.
| Compound Name | 1-(4-hydroxy-5-oxocyclohepta-1,3,6-trien-1-yl)-3-(2-oxochromen-3-yl)urea |
|---|---|
| PubChem CID | 44623778 |
| Molecular Formula | C17H12N2O5 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-(4-hydroxy-5-oxocyclohepta-1,3,6-trien-1-yl)-3-(2-oxochromen-3-yl)urea |
| SMILES | O=C(Nc1ccc(O)c(=O)cc1)Nc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H12N2O5/c20-13-7-5-11(6-8-14(13)21)18-17(23)19-12-9-10-3-1-2-4-15(10)24-16(12)22/h1-9H,(H,20,21)(H2,18,19,23) |
| InChIKey | XSASVBXPIWHBNJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|