C26H32N4O3S — CID 44625406
2-[5-[[2-[(4-methyl-1-sulfanylpentan-2-yl)carbamoyl]-4-propyl-1H-imidazol-5-yl]methyl]-2-pyridinyl]benzoic acid (PubChem CID 44625406) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is 2-[5-[[2-[(4-methyl-1-sulfanylpentan-2-yl)carbamoyl]-4-propyl-1H-imidazol-5-yl]methyl]-2-pyridinyl]benzoic acid.
| Compound Name | 2-[5-[[2-[(4-methyl-1-sulfanylpentan-2-yl)carbamoyl]-4-propyl-1H-imidazol-5-yl]methyl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 44625406 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[5-[[2-[(4-methyl-1-sulfanylpentan-2-yl)carbamoyl]-4-propyl-1H-imidazol-5-yl]methyl]-2-pyridinyl]benzoic acid |
| SMILES | CCCc1nc(C(=O)NC(CS)CC(C)C)[nH]c1Cc1ccc(-c2ccccc2C(=O)O)nc1 |
| InChI | InChI=1S/C26H32N4O3S/c1-4-7-22-23(30-24(29-22)25(31)28-18(15-34)12-16(2)3)13-17-10-11-21(27-14-17)19-8-5-6-9-20(19)26(32)33/h5-6,8-11,14,16,18,34H,4,7,12-13,15H2,1-3H3,(H,28,31)(H,29,30)(H,32,33) |
| InChIKey | MVMOUOGIHHXJRF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|