C27H28N6O3S — CID 44625488
N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide (PubChem CID 44625488) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide.
| Compound Name | N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 44625488 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-cyclopropyl-4-[[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzamide |
| SMILES | O=C(NC1CC1)c1ccc(Nc2nc3cccc(-c4ccc(CN5CCS(=O)(=O)CC5)cc4)n3n2)cc1 |
| InChI | InChI=1S/C27H28N6O3S/c34-26(28-22-12-13-22)21-8-10-23(11-9-21)29-27-30-25-3-1-2-24(33(25)31-27)20-6-4-19(5-7-20)18-32-14-16-37(35,36)17-15-32/h1-11,22H,12-18H2,(H,28,34)(H,29,31) |
| InChIKey | ITVPTHMMZXRDGJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |