C21H23Cl2N5OS — CID 44627463
5-[5-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole (PubChem CID 44627463) has the molecular formula C21H23Cl2N5OS and a molecular weight of 464.42 g/mol. Its IUPAC name is 5-[5-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole.
| Compound Name | 5-[5-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 44627463 |
| Molecular Formula | C21H23Cl2N5OS |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 5-[5-[3-[(1R,5S)-1-(3,4-dichlorophenyl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole |
| SMILES | Cc1ncoc1-c1nnc(SCCCN2C[C@H]3C[C@@]3(c3ccc(Cl)c(Cl)c3)C2)n1C |
| InChI | InChI=1S/C21H23Cl2N5OS/c1-13-18(29-12-24-13)19-25-26-20(27(19)2)30-7-3-6-28-10-15-9-21(15,11-28)14-4-5-16(22)17(23)8-14/h4-5,8,12,15H,3,6-7,9-11H2,1-2H3/t15-,21+/m1/s1 |
| InChIKey | OTIQETSFLFLTJQ-VFNWGFHPSA-N |
| XLogP | 4.84 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|