C23H26N6OS2 — CID 66671155
4-methyl-5-[4-methyl-5-[3-[(1R,5R)-1-(2-methyl-1,3-benzothiazol-5-yl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole (PubChem CID 66671155) has the molecular formula C23H26N6OS2 and a molecular weight of 466.64 g/mol. Its IUPAC name is 4-methyl-5-[4-methyl-5-[3-[(1R,5R)-1-(2-methyl-1,3-benzothiazol-5-yl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole.
| Compound Name | 4-methyl-5-[4-methyl-5-[3-[(1R,5R)-1-(2-methyl-1,3-benzothiazol-5-yl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 66671155 |
| Molecular Formula | C23H26N6OS2 |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 4-methyl-5-[4-methyl-5-[3-[(1R,5R)-1-(2-methyl-1,3-benzothiazol-5-yl)-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole |
| SMILES | Cc1nc2cc([C@@]34C[C@H]3CN(CCCSc3nnc(-c5ocnc5C)n3C)C4)ccc2s1 |
| InChI | InChI=1S/C23H26N6OS2/c1-14-20(30-13-24-14)21-26-27-22(28(21)3)31-8-4-7-29-11-17-10-23(17,12-29)16-5-6-19-18(9-16)25-15(2)32-19/h5-6,9,13,17H,4,7-8,10-12H2,1-3H3/t17-,23-/m0/s1 |
| InChIKey | UAOBDKREOZMZJQ-SBUREZEXSA-N |
| XLogP | 4.45 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|