C22H27NO9S — CID 44628396
3-[2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethoxysulfonyl]benzoic acid (PubChem CID 44628396) has the molecular formula C22H27NO9S and a molecular weight of 481.52 g/mol. Its IUPAC name is 3-[2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethoxysulfonyl]benzoic acid.
| Compound Name | 3-[2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethoxysulfonyl]benzoic acid |
|---|---|
| PubChem CID | 44628396 |
| Molecular Formula | C22H27NO9S |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 3-[2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethoxysulfonyl]benzoic acid |
| SMILES | CC12OC(=O)C1(C(O)C1CCCCC1)NC(=O)C2CCOS(=O)(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C22H27NO9S/c1-21-16(10-11-31-33(29,30)15-9-5-8-14(12-15)19(26)27)18(25)23-22(21,20(28)32-21)17(24)13-6-3-2-4-7-13/h5,8-9,12-13,16-17,24H,2-4,6-7,10-11H2,1H3,(H,23,25)(H,26,27) |
| InChIKey | JLCCVSACIQDIHS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|