C22H26FNO6 — CID 44628548
2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 2-fluorobenzoate (PubChem CID 44628548) has the molecular formula C22H26FNO6 and a molecular weight of 419.45 g/mol. Its IUPAC name is 2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 2-fluorobenzoate.
| Compound Name | 2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 44628548 |
| Molecular Formula | C22H26FNO6 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[1-[cyclohexyl(hydroxy)methyl]-5-methyl-3,7-dioxo-6-oxa-2-azabicyclo[3.2.0]heptan-4-yl]ethyl 2-fluorobenzoate |
| SMILES | CC12OC(=O)C1(C(O)C1CCCCC1)NC(=O)C2CCOC(=O)c1ccccc1F |
| InChI | InChI=1S/C22H26FNO6/c1-21-15(11-12-29-19(27)14-9-5-6-10-16(14)23)18(26)24-22(21,20(28)30-21)17(25)13-7-3-2-4-8-13/h5-6,9-10,13,15,17,25H,2-4,7-8,11-12H2,1H3,(H,24,26) |
| InChIKey | FXJCBTSPUBXXMM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|