About (cyclohexylamino) 2-fluorobenzoate
(cyclohexylamino) 2-fluorobenzoate (PubChem CID 144857629) has the molecular formula C13H16FNO2
and a molecular weight of 237.27 g/mol. Its IUPAC name is (cyclohexylamino) 2-fluorobenzoate.
Molecular Properties
| Compound Name | (cyclohexylamino) 2-fluorobenzoate |
| PubChem CID | 144857629 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (cyclohexylamino) 2-fluorobenzoate |
| SMILES | O=C(ONC1CCCCC1)c1ccccc1F |
| InChI | InChI=1S/C13H16FNO2/c14-12-9-5-4-8-11(12)13(16)17-15-10-6-2-1-3-7-10/h4-5,8-10,15H,1-3,6-7H2 |
| InChIKey | PNTGVHYDQDIPTA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyclohexylamino) 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclohexylamino) 2-fluorobenzoate?
The IUPAC name of (cyclohexylamino) 2-fluorobenzoate (CID 144857629) is (cyclohexylamino) 2-fluorobenzoate.
What is the SMILES notation for (cyclohexylamino) 2-fluorobenzoate?
The canonical SMILES for (cyclohexylamino) 2-fluorobenzoate is O=C(ONC1CCCCC1)c1ccccc1F.
What is the InChIKey of (cyclohexylamino) 2-fluorobenzoate?
The InChIKey is PNTGVHYDQDIPTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO2/c14-12-9-5-4-8-11(12)13(16)17-15-10-6-2-1-3-7-10/h4-5,8-10,15H,1-3,6-7H2.
What are the key properties of (cyclohexylamino) 2-fluorobenzoate?
(cyclohexylamino) 2-fluorobenzoate has a molecular weight of 237.27 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclohexylamino) 2-fluorobenzoate is sourced from PubChem (CID 144857629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).