About bromo 2-fluorobenzoate
bromo 2-fluorobenzoate (PubChem CID 68843510) has the molecular formula C7H4BrFO2
and a molecular weight of 219.01 g/mol. Its IUPAC name is bromo 2-fluorobenzoate.
Molecular Properties
| Compound Name | bromo 2-fluorobenzoate |
| PubChem CID | 68843510 |
| Molecular Formula | C7H4BrFO2 |
| Molecular Weight | 219.01 g/mol |
| Exact Mass | 217.94 |
| IUPAC Name | bromo 2-fluorobenzoate |
| SMILES | O=C(OBr)c1ccccc1F |
| InChI | InChI=1S/C7H4BrFO2/c8-11-7(10)5-3-1-2-4-6(5)9/h1-4H |
| InChIKey | KRXZQYHIQCXRAE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.01 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bromo 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo 2-fluorobenzoate?
The IUPAC name of bromo 2-fluorobenzoate (CID 68843510) is bromo 2-fluorobenzoate.
What is the SMILES notation for bromo 2-fluorobenzoate?
The canonical SMILES for bromo 2-fluorobenzoate is O=C(OBr)c1ccccc1F.
What is the InChIKey of bromo 2-fluorobenzoate?
The InChIKey is KRXZQYHIQCXRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrFO2/c8-11-7(10)5-3-1-2-4-6(5)9/h1-4H.
What are the key properties of bromo 2-fluorobenzoate?
bromo 2-fluorobenzoate has a molecular weight of 219.01 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 2-fluorobenzoate is sourced from PubChem (CID 68843510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).