C27H44N3O5+ — CID 44629575
[(2R,4S,5S)-1-(butylamino)-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-1,9-dioxononan-5-yl]azanium (PubChem CID 44629575) has the molecular formula C27H44N3O5+ and a molecular weight of 490.67 g/mol. Its IUPAC name is [(2R,4S,5S)-1-(butylamino)-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-1,9-dioxononan-5-yl]azanium.
| Compound Name | [(2R,4S,5S)-1-(butylamino)-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-1,9-dioxononan-5-yl]azanium |
|---|---|
| PubChem CID | 44629575 |
| Molecular Formula | C27H44N3O5+ |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [(2R,4S,5S)-1-(butylamino)-4-hydroxy-9-[(3R)-3-methoxycarbonyl-3,4-dihydro-2H-quinolin-1-yl]-2,7,7-trimethyl-1,9-dioxononan-5-yl]azanium |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H]([NH3+])CC(C)(C)CC(=O)N1C[C@H](C(=O)OC)Cc2ccccc21 |
| InChI | InChI=1S/C27H43N3O5/c1-6-7-12-29-25(33)18(2)13-23(31)21(28)15-27(3,4)16-24(32)30-17-20(26(34)35-5)14-19-10-8-9-11-22(19)30/h8-11,18,20-21,23,31H,6-7,12-17,28H2,1-5H3,(H,29,33)/p+1/t18-,20-,21+,23+/m1/s1 |
| InChIKey | VROPGBJWKDHPPG-WQJYWUQFSA-O |
| XLogP | 2.09 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|