C15H16O4 — CID 44631634
9-hydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),8-triene-5,10-dione (PubChem CID 44631634) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 9-hydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),8-triene-5,10-dione.
| Compound Name | 9-hydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),8-triene-5,10-dione |
|---|---|
| PubChem CID | 44631634 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 9-hydroxy-3,3,7,11-tetramethyl-2-oxatricyclo[6.3.1.04,12]dodeca-1(11),4(12),8-triene-5,10-dione |
| SMILES | CC1=C2OC(C)(C)C3=C2C(=C(O)C1=O)C(C)CC3=O |
| InChI | InChI=1S/C15H16O4/c1-6-5-8(16)11-10-9(6)13(18)12(17)7(2)14(10)19-15(11,3)4/h6,18H,5H2,1-4H3 |
| InChIKey | BOLNVNUMUYBVRU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |