C14H22O5S2 — CID 44631685
methyl 4-(5-methoxy-5-oxopentyl)-2,2-dimethyl-5-oxo-1,3-dithiane-4-carboxylate (PubChem CID 44631685) has the molecular formula C14H22O5S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is methyl 4-(5-methoxy-5-oxopentyl)-2,2-dimethyl-5-oxo-1,3-dithiane-4-carboxylate.
| Compound Name | methyl 4-(5-methoxy-5-oxopentyl)-2,2-dimethyl-5-oxo-1,3-dithiane-4-carboxylate |
|---|---|
| PubChem CID | 44631685 |
| Molecular Formula | C14H22O5S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 4-(5-methoxy-5-oxopentyl)-2,2-dimethyl-5-oxo-1,3-dithiane-4-carboxylate |
| SMILES | COC(=O)CCCCC1(C(=O)OC)SC(C)(C)SCC1=O |
| InChI | InChI=1S/C14H22O5S2/c1-13(2)20-9-10(15)14(21-13,12(17)19-4)8-6-5-7-11(16)18-3/h5-9H2,1-4H3 |
| InChIKey | DUJBCNNYAXTAFD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|