methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate

C14H20O5 — CID 6431773

IUPACmethyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate
SMILESCOC(=O)CCCC(=O)C1C(=O)CC(C)(C)CC1=O
InChIInChI=1S/C14H20O5/c1-14(2)7-10(16)13(11(17)8-14)9(15)5-4-6-12(18)19-3/h13H,4-8H2,1-3H3
InChIKeyHPNGSLHMOVJDNL-UHFFFAOYSA-N
MW268.31 g/mol
LogP1.47
Rot. Bonds5

About methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate

methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate (PubChem CID 6431773) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate.

Molecular Properties

Compound Namemethyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate
PubChem CID6431773
Molecular FormulaC14H20O5
Molecular Weight268.31 g/mol
Exact Mass268.13
IUPAC Namemethyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate
SMILESCOC(=O)CCCC(=O)C1C(=O)CC(C)(C)CC1=O
InChIInChI=1S/C14H20O5/c1-14(2)7-10(16)13(11(17)8-14)9(15)5-4-6-12(18)19-3/h13H,4-8H2,1-3H3
InChIKeyHPNGSLHMOVJDNL-UHFFFAOYSA-N
XLogP1.47
TPSA77.51 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 51.47
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate?
The IUPAC name of methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate (CID 6431773) is methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate.
What is the SMILES notation for methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate?
The canonical SMILES for methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate is COC(=O)CCCC(=O)C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate?
The InChIKey is HPNGSLHMOVJDNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-14(2)7-10(16)13(11(17)8-14)9(15)5-4-6-12(18)19-3/h13H,4-8H2,1-3H3.
What are the key properties of methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate?
methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate has a molecular weight of 268.31 g/mol, XLogP of 1.47, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(4,4-dimethyl-2,6-dioxocyclohexyl)-5-oxopentanoate is sourced from PubChem (CID 6431773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).