C16H22NO6- — CID 7306079
3-[[2-(4-methoxy-4-oxobutanoyl)-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoate (PubChem CID 7306079) has the molecular formula C16H22NO6- and a molecular weight of 324.35 g/mol. Its IUPAC name is 3-[[2-(4-methoxy-4-oxobutanoyl)-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoate.
| Compound Name | 3-[[2-(4-methoxy-4-oxobutanoyl)-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoate |
|---|---|
| PubChem CID | 7306079 |
| Molecular Formula | C16H22NO6- |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[[2-(4-methoxy-4-oxobutanoyl)-5,5-dimethyl-3-oxocyclohexylidene]amino]propanoate |
| SMILES | COC(=O)CCC(=O)C1C(=O)CC(C)(C)C/C1=N\CCC(=O)[O-] |
| InChI | InChI=1S/C16H23NO6/c1-16(2)8-10(17-7-6-13(20)21)15(12(19)9-16)11(18)4-5-14(22)23-3/h15H,4-9H2,1-3H3,(H,20,21)/p-1/b17-10+ |
| InChIKey | OXBHTLWWCDZGIQ-LICLKQGHSA-M |
| XLogP | 0.09 |
| TPSA | 112.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|