C20H31NO6 — CID 7426928
6-[[(2R,4R)-2-butanoyl-4-methoxycarbonyl-5,5-dimethyl-3-oxocyclohexylidene]amino]hexanoic acid (PubChem CID 7426928) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is 6-[[(2R,4R)-2-butanoyl-4-methoxycarbonyl-5,5-dimethyl-3-oxocyclohexylidene]amino]hexanoic acid.
| Compound Name | 6-[[(2R,4R)-2-butanoyl-4-methoxycarbonyl-5,5-dimethyl-3-oxocyclohexylidene]amino]hexanoic acid |
|---|---|
| PubChem CID | 7426928 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 6-[[(2R,4R)-2-butanoyl-4-methoxycarbonyl-5,5-dimethyl-3-oxocyclohexylidene]amino]hexanoic acid |
| SMILES | CCCC(=O)[C@@H]1C(=O)[C@H](C(=O)OC)C(C)(C)C/C1=N\CCCCCC(=O)O |
| InChI | InChI=1S/C20H31NO6/c1-5-9-14(22)16-13(21-11-8-6-7-10-15(23)24)12-20(2,3)17(18(16)25)19(26)27-4/h16-17H,5-12H2,1-4H3,(H,23,24)/b21-13+/t16-,17-/m1/s1 |
| InChIKey | MUXONQVZSASTJA-MCVCKHRISA-N |
| XLogP | 2.85 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|