C20H29NO6 — CID 76763991
methyl 6-[(1S,2S)-2-[(1S)-1-cyano-2-ethoxy-2-oxoethyl]-4,4-dimethyl-6-oxocyclohexyl]-6-oxohexanoate (PubChem CID 76763991) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is methyl 6-[(1S,2S)-2-[(1S)-1-cyano-2-ethoxy-2-oxoethyl]-4,4-dimethyl-6-oxocyclohexyl]-6-oxohexanoate.
| Compound Name | methyl 6-[(1S,2S)-2-[(1S)-1-cyano-2-ethoxy-2-oxoethyl]-4,4-dimethyl-6-oxocyclohexyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 76763991 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | methyl 6-[(1S,2S)-2-[(1S)-1-cyano-2-ethoxy-2-oxoethyl]-4,4-dimethyl-6-oxocyclohexyl]-6-oxohexanoate |
| SMILES | CCOC(=O)[C@H](C#N)[C@H]1CC(C)(C)CC(=O)[C@@H]1C(=O)CCCCC(=O)OC |
| InChI | InChI=1S/C20H29NO6/c1-5-27-19(25)14(12-21)13-10-20(2,3)11-16(23)18(13)15(22)8-6-7-9-17(24)26-4/h13-14,18H,5-11H2,1-4H3/t13-,14-,18+/m1/s1 |
| InChIKey | HPALREGCJDAQPA-LBTNJELSSA-N |
| XLogP | 2.61 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|