C16H17NO5 — CID 44631943
(1S,18R,19S,20S)-5,7,13-trioxa-12-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-2,4(8),9,16-tetraene-18,19-diol (PubChem CID 44631943) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is (1S,18R,19S,20S)-5,7,13-trioxa-12-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-2,4(8),9,16-tetraene-18,19-diol.
| Compound Name | (1S,18R,19S,20S)-5,7,13-trioxa-12-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-2,4(8),9,16-tetraene-18,19-diol |
|---|---|
| PubChem CID | 44631943 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (1S,18R,19S,20S)-5,7,13-trioxa-12-azapentacyclo[10.7.1.02,10.04,8.016,20]icosa-2,4(8),9,16-tetraene-18,19-diol |
| SMILES | O[C@H]1[C@H]2c3cc4c(cc3CN3OCCC(=C[C@H]1O)[C@H]23)OCO4 |
| InChI | InChI=1S/C16H17NO5/c18-11-3-8-1-2-22-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19/h3-5,11,14-16,18-19H,1-2,6-7H2/t11-,14+,15-,16-/m1/s1 |
| InChIKey | JGBGFTFPFIMGIJ-MSQAHXEGSA-N |
| XLogP | 0.68 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|