C25H32O3Si — CID 44632186
methyl (2E,4Z)-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhexa-2,4-dienoate (PubChem CID 44632186) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is methyl (2E,4Z)-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhexa-2,4-dienoate.
| Compound Name | methyl (2E,4Z)-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhexa-2,4-dienoate |
|---|---|
| PubChem CID | 44632186 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | methyl (2E,4Z)-6-[tert-butyl(diphenyl)silyl]oxy-2,5-dimethylhexa-2,4-dienoate |
| SMILES | COC(=O)/C(C)=C/C=C(/C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O3Si/c1-20(17-18-21(2)24(26)27-6)19-28-29(25(3,4)5,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-18H,19H2,1-6H3/b20-17-,21-18+ |
| InChIKey | RZUPLJNHEVPFJA-WPDZNWIASA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|