C27H35NO6S — CID 44632447
(2R,4aR,6S,7S,8R,8aR)-N-cyclohexyl-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine (PubChem CID 44632447) has the molecular formula C27H35NO6S and a molecular weight of 501.65 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-N-cyclohexyl-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-N-cyclohexyl-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
|---|---|
| PubChem CID | 44632447 |
| Molecular Formula | C27H35NO6S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-N-cyclohexyl-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-amine |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1NC1CCCCC1 |
| InChI | InChI=1S/C27H35NO6S/c1-18-13-15-21(16-14-18)35(29,30)25-23(28-20-11-7-4-8-12-20)27(31-2)33-22-17-32-26(34-24(22)25)19-9-5-3-6-10-19/h3,5-6,9-10,13-16,20,22-28H,4,7-8,11-12,17H2,1-2H3/t22-,23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | UHNDTYFPROEQCF-XXVOEFFYSA-N |
| XLogP | 3.91 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |