C37H41NO6S — CID 44632450
(2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2-(trityloxymethyl)oxan-3-ol (PubChem CID 44632450) has the molecular formula C37H41NO6S and a molecular weight of 627.80 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 44632450 |
| Molecular Formula | C37H41NO6S |
| Molecular Weight | 627.80 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-pyrrolidin-1-yl-2-(trityloxymethyl)oxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1N1CCCC1 |
| InChI | InChI=1S/C37H41NO6S/c1-27-20-22-31(23-21-27)45(40,41)35-33(38-24-12-13-25-38)36(42-2)44-32(34(35)39)26-43-37(28-14-6-3-7-15-28,29-16-8-4-9-17-29)30-18-10-5-11-19-30/h3-11,14-23,32-36,39H,12-13,24-26H2,1-2H3/t32-,33-,34-,35-,36-/m1/s1 |
| InChIKey | JRJRUQCLKQYYNX-JZPVOVDPSA-N |
| XLogP | 5.34 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.80 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|