C36H41NO6S — CID 44632449
(2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-(propan-2-ylamino)-2-(trityloxymethyl)oxan-3-ol (PubChem CID 44632449) has the molecular formula C36H41NO6S and a molecular weight of 615.79 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-(propan-2-ylamino)-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-(propan-2-ylamino)-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 44632449 |
| Molecular Formula | C36H41NO6S |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-(propan-2-ylamino)-2-(trityloxymethyl)oxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1NC(C)C |
| InChI | InChI=1S/C36H41NO6S/c1-25(2)37-32-34(44(39,40)30-22-20-26(3)21-23-30)33(38)31(43-35(32)41-4)24-42-36(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-23,25,31-35,37-38H,24H2,1-4H3/t31-,32-,33-,34-,35-/m1/s1 |
| InChIKey | XBUZAULZBAOIKV-ZQPTVKGJSA-N |
| XLogP | 5.24 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|