C25H31NO6S — CID 44632448
1-[(2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]pyrrolidine (PubChem CID 44632448) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is 1-[(2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]pyrrolidine.
| Compound Name | 1-[(2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]pyrrolidine |
|---|---|
| PubChem CID | 44632448 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[(2R,4aR,6S,7S,8R,8aR)-6-methoxy-8-(4-methylphenyl)sulfonyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]pyrrolidine |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1N1CCCC1 |
| InChI | InChI=1S/C25H31NO6S/c1-17-10-12-19(13-11-17)33(27,28)23-21(26-14-6-7-15-26)25(29-2)31-20-16-30-24(32-22(20)23)18-8-4-3-5-9-18/h3-5,8-13,20-25H,6-7,14-16H2,1-2H3/t20-,21-,22-,23-,24-,25+/m1/s1 |
| InChIKey | MFIOWMRVOSBSPV-CRNSPECLSA-N |
| XLogP | 3.09 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |