C38H43NO6S — CID 44632451
(2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-2-(trityloxymethyl)oxan-3-ol (PubChem CID 44632451) has the molecular formula C38H43NO6S and a molecular weight of 641.83 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 44632451 |
| Molecular Formula | C38H43NO6S |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | (2R,3R,4R,5S,6R)-6-methoxy-4-(4-methylphenyl)sulfonyl-5-piperidin-1-yl-2-(trityloxymethyl)oxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C38H43NO6S/c1-28-21-23-32(24-22-28)46(41,42)36-34(39-25-13-6-14-26-39)37(43-2)45-33(35(36)40)27-44-38(29-15-7-3-8-16-29,30-17-9-4-10-18-30)31-19-11-5-12-20-31/h3-5,7-12,15-24,33-37,40H,6,13-14,25-27H2,1-2H3/t33-,34-,35-,36-,37-/m1/s1 |
| InChIKey | NXPWCZUIVXXZAQ-LQHPVFTQSA-N |
| XLogP | 5.73 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|