C17H24N2O — CID 44633344
N-[1-(2,3-dimethylphenyl)-3-methylidenepentyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 44633344) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-[1-(2,3-dimethylphenyl)-3-methylidenepentyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | N-[1-(2,3-dimethylphenyl)-3-methylidenepentyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 44633344 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-[1-(2,3-dimethylphenyl)-3-methylidenepentyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | C=C(CC)CC(NC1=NCCO1)c1cccc(C)c1C |
| InChI | InChI=1S/C17H24N2O/c1-5-12(2)11-16(19-17-18-9-10-20-17)15-8-6-7-13(3)14(15)4/h6-8,16H,2,5,9-11H2,1,3-4H3,(H,18,19) |
| InChIKey | HBHKPYNBCATMCT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|