C19H28O3S — CID 44640133
(3R)-5-methyl-3-[2-[(1S)-2-methyl-1-phenylpropyl]sulfanyl-2-oxoethyl]hexanoic acid (PubChem CID 44640133) has the molecular formula C19H28O3S and a molecular weight of 336.50 g/mol. Its IUPAC name is (3R)-5-methyl-3-[2-[(1S)-2-methyl-1-phenylpropyl]sulfanyl-2-oxoethyl]hexanoic acid.
| Compound Name | (3R)-5-methyl-3-[2-[(1S)-2-methyl-1-phenylpropyl]sulfanyl-2-oxoethyl]hexanoic acid |
|---|---|
| PubChem CID | 44640133 |
| Molecular Formula | C19H28O3S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (3R)-5-methyl-3-[2-[(1S)-2-methyl-1-phenylpropyl]sulfanyl-2-oxoethyl]hexanoic acid |
| SMILES | CC(C)C[C@H](CC(=O)O)CC(=O)S[C@H](c1ccccc1)C(C)C |
| InChI | InChI=1S/C19H28O3S/c1-13(2)10-15(11-17(20)21)12-18(22)23-19(14(3)4)16-8-6-5-7-9-16/h5-9,13-15,19H,10-12H2,1-4H3,(H,20,21)/t15-,19+/m1/s1 |
| InChIKey | XBBGKZLPDWMOMG-BEFAXECRSA-N |
| XLogP | 5.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|