About decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride
decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride (PubChem CID 44654754) has the molecular formula C22H43ClN2O4
and a molecular weight of 435.05 g/mol. Its IUPAC name is decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride.
Molecular Properties
| Compound Name | decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride |
| PubChem CID | 44654754 |
| Molecular Formula | C22H43ClN2O4 |
| Molecular Weight | 435.05 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride |
| SMILES | CCCCCCCCCCOC(=O)C[N+]1(CCN2CCOCC2)CCOCC1.[Cl-] |
| InChI | InChI=1S/C22H43N2O4.ClH/c1-2-3-4-5-6-7-8-9-16-28-22(25)21-24(14-19-27-20-15-24)13-10-23-11-17-26-18-12-23;/h2-21H2,1H3;1H/q+1;/p-1 |
| InChIKey | BZCRFDDRQWXLCV-UHFFFAOYSA-M |
| XLogP | -0.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.05 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride?
The IUPAC name of decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride (CID 44654754) is decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride.
What is the SMILES notation for decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride?
The canonical SMILES for decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride is CCCCCCCCCCOC(=O)C[N+]1(CCN2CCOCC2)CCOCC1.[Cl-].
What is the InChIKey of decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride?
The InChIKey is BZCRFDDRQWXLCV-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H43N2O4.ClH/c1-2-3-4-5-6-7-8-9-16-28-22(25)21-24(14-19-27-20-15-24)13-10-23-11-17-26-18-12-23;/h2-21H2,1H3;1H/q+1;/p-1.
What are the key properties of decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride?
decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride has a molecular weight of 435.05 g/mol, XLogP of -0.15, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 2-[4-(2-morpholin-4-ylethyl)morpholin-4-ium-4-yl]acetate chloride is sourced from PubChem (CID 44654754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).