C15H16IN3O2S — CID 44655353
1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-(1,3-thiazol-2-ylamino)ethanone;hydroiodide (PubChem CID 44655353) has the molecular formula C15H16IN3O2S and a molecular weight of 429.28 g/mol. Its IUPAC name is 1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-(1,3-thiazol-2-ylamino)ethanone;hydroiodide.
| Compound Name | 1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-(1,3-thiazol-2-ylamino)ethanone;hydroiodide |
|---|---|
| PubChem CID | 44655353 |
| Molecular Formula | C15H16IN3O2S |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 1-(5-methoxy-2-methyl-1H-indol-3-yl)-2-(1,3-thiazol-2-ylamino)ethanone;hydroiodide |
| SMILES | COc1ccc2[nH]c(C)c(C(=O)CNc3nccs3)c2c1.I |
| InChI | InChI=1S/C15H15N3O2S.HI/c1-9-14(13(19)8-17-15-16-5-6-21-15)11-7-10(20-2)3-4-12(11)18-9;/h3-7,18H,8H2,1-2H3,(H,16,17);1H |
| InChIKey | IZXVEHUVYKQHAK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|