C23H29IN2O — CID 44656002
14-butyl-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde iodide (PubChem CID 44656002) has the molecular formula C23H29IN2O and a molecular weight of 476.40 g/mol. Its IUPAC name is 14-butyl-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde iodide.
| Compound Name | 14-butyl-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde iodide |
|---|---|
| PubChem CID | 44656002 |
| Molecular Formula | C23H29IN2O |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 14-butyl-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde iodide |
| SMILES | CC=C1C[N+]2(CCCC)CCC34C(=C(C=O)C1CC32)Nc1ccccc14.[I-] |
| InChI | InChI=1S/C23H28N2O.HI/c1-3-5-11-25-12-10-23-19-8-6-7-9-20(19)24-22(23)18(15-26)17(13-21(23)25)16(4-2)14-25;/h4,6-9,15,17,21H,3,5,10-14H2,1-2H3;1H |
| InChIKey | PJYLZVWATFEZJZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|