C24H31N2O+ — CID 6140901
(12E)-12-ethylidene-14-pentyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde (PubChem CID 6140901) has the molecular formula C24H31N2O+ and a molecular weight of 363.53 g/mol. Its IUPAC name is (12E)-12-ethylidene-14-pentyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde.
| Compound Name | (12E)-12-ethylidene-14-pentyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde |
|---|---|
| PubChem CID | 6140901 |
| Molecular Formula | C24H31N2O+ |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (12E)-12-ethylidene-14-pentyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde |
| SMILES | C/C=C1/C[N+]2(CCCCC)CCC34C(=C(C=O)C1CC32)Nc1ccccc14 |
| InChI | InChI=1S/C24H30N2O/c1-3-5-8-12-26-13-11-24-20-9-6-7-10-21(20)25-23(24)19(16-27)18(14-22(24)26)17(4-2)15-26/h4,6-7,9-10,16,18,22H,3,5,8,11-15H2,1-2H3/p+1/b17-4- |
| InChIKey | XQRRSKKQLILQOC-INGKJJEOSA-O |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|