C24H32ClN3O — CID 44659379
1-(2,6-dimethyl-1H-indol-3-yl)-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]ethanol chloride (PubChem CID 44659379) has the molecular formula C24H32ClN3O and a molecular weight of 413.99 g/mol. Its IUPAC name is 1-(2,6-dimethyl-1H-indol-3-yl)-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]ethanol chloride.
| Compound Name | 1-(2,6-dimethyl-1H-indol-3-yl)-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]ethanol chloride |
|---|---|
| PubChem CID | 44659379 |
| Molecular Formula | C24H32ClN3O |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-(2,6-dimethyl-1H-indol-3-yl)-2-[4-(2,3-dimethylphenyl)piperazin-1-ium-1-yl]ethanol chloride |
| SMILES | Cc1ccc2c(C(O)C[NH+]3CCN(c4cccc(C)c4C)CC3)c(C)[nH]c2c1.[Cl-] |
| InChI | InChI=1S/C24H31N3O.ClH/c1-16-8-9-20-21(14-16)25-19(4)24(20)23(28)15-26-10-12-27(13-11-26)22-7-5-6-17(2)18(22)3;/h5-9,14,23,25,28H,10-13,15H2,1-4H3;1H |
| InChIKey | OXICXOUMZQJXBG-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|