C29H46ClNO4 — CID 44660647
[(10R,13S,16R)-17-acetyl-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-morpholin-4-ium-4-ylpropanoate chloride (PubChem CID 44660647) has the molecular formula C29H46ClNO4 and a molecular weight of 508.14 g/mol. Its IUPAC name is [(10R,13S,16R)-17-acetyl-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-morpholin-4-ium-4-ylpropanoate chloride.
| Compound Name | [(10R,13S,16R)-17-acetyl-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-morpholin-4-ium-4-ylpropanoate chloride |
|---|---|
| PubChem CID | 44660647 |
| Molecular Formula | C29H46ClNO4 |
| Molecular Weight | 508.14 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | [(10R,13S,16R)-17-acetyl-10,13,16-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-morpholin-4-ium-4-ylpropanoate chloride |
| SMILES | CC(=O)C1[C@H](C)CC2C3CC=C4CC(OC(=O)CC[NH+]5CCOCC5)CC[C@]4(C)C3CC[C@@]21C.[Cl-] |
| InChI | InChI=1S/C29H45NO4.ClH/c1-19-17-25-23-6-5-21-18-22(34-26(32)9-12-30-13-15-33-16-14-30)7-10-28(21,3)24(23)8-11-29(25,4)27(19)20(2)31;/h5,19,22-25,27H,6-18H2,1-4H3;1H/t19-,22?,23?,24?,25?,27?,28+,29+;/m1./s1 |
| InChIKey | KHVGBIBAEZUHEK-HSFRKOMYSA-N |
| XLogP | 0.62 |
| TPSA | 57.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|