C25H25ClF2N2O — CID 44661042
bis[(4-fluorophenyl)methyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride (PubChem CID 44661042) has the molecular formula C25H25ClF2N2O and a molecular weight of 442.94 g/mol. Its IUPAC name is bis[(4-fluorophenyl)methyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride.
| Compound Name | bis[(4-fluorophenyl)methyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride |
|---|---|
| PubChem CID | 44661042 |
| Molecular Formula | C25H25ClF2N2O |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | bis[(4-fluorophenyl)methyl]-[2-(5-methoxy-1H-indol-3-yl)ethyl]azanium chloride |
| SMILES | COc1ccc2[nH]cc(CC[NH+](Cc3ccc(F)cc3)Cc3ccc(F)cc3)c2c1.[Cl-] |
| InChI | InChI=1S/C25H24F2N2O.ClH/c1-30-23-10-11-25-24(14-23)20(15-28-25)12-13-29(16-18-2-6-21(26)7-3-18)17-19-4-8-22(27)9-5-19;/h2-11,14-15,28H,12-13,16-17H2,1H3;1H |
| InChIKey | RLSBGNPNUUBZST-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |