C15H20ClN3O2 — CID 44662181
[(2R)-1-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride (PubChem CID 44662181) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is [(2R)-1-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride.
| Compound Name | [(2R)-1-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 44662181 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(2R)-1-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-3-methyl-1-oxobutan-2-yl]azanium chloride |
| SMILES | CC(C)[C@@H]([NH3+])C(=O)N/N=C/C1=Cc2ccccc2OC1.[Cl-] |
| InChI | InChI=1S/C15H19N3O2.ClH/c1-10(2)14(16)15(19)18-17-8-11-7-12-5-3-4-6-13(12)20-9-11;/h3-8,10,14H,9,16H2,1-2H3,(H,18,19);1H/b17-8+;/t14-;/m1./s1 |
| InChIKey | GIMAZPYPUQLTJQ-NULWPXEDSA-N |
| XLogP | -2.17 |
| TPSA | 78.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|