C21H29N3O4 — CID 6887591
tert-butyl N-[6-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-6-oxohexyl]carbamate (PubChem CID 6887591) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl N-[6-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 6887591 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl N-[6-[(2E)-2-(2H-chromen-3-ylmethylidene)hydrazinyl]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N/N=C/C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C21H29N3O4/c1-21(2,3)28-20(26)22-12-8-4-5-11-19(25)24-23-14-16-13-17-9-6-7-10-18(17)27-15-16/h6-7,9-10,13-14H,4-5,8,11-12,15H2,1-3H3,(H,22,26)(H,24,25)/b23-14+ |
| InChIKey | UJWFGRDIGZFUJZ-OEAKJJBVSA-N |
| XLogP | 3.65 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|