C20H29BrN2O4 — CID 44662928
1-[(2-bromophenyl)methyl]-4-(4-methylpiperidin-1-ium-1-yl)piperidine;2-hydroxy-2-oxoacetate (PubChem CID 44662928) has the molecular formula C20H29BrN2O4 and a molecular weight of 441.37 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-4-(4-methylpiperidin-1-ium-1-yl)piperidine;2-hydroxy-2-oxoacetate.
| Compound Name | 1-[(2-bromophenyl)methyl]-4-(4-methylpiperidin-1-ium-1-yl)piperidine;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44662928 |
| Molecular Formula | C20H29BrN2O4 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-4-(4-methylpiperidin-1-ium-1-yl)piperidine;2-hydroxy-2-oxoacetate |
| SMILES | CC1CC[NH+](C2CCN(Cc3ccccc3Br)CC2)CC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C18H27BrN2.C2H2O4/c1-15-6-12-21(13-7-15)17-8-10-20(11-9-17)14-16-4-2-3-5-18(16)19;3-1(4)2(5)6/h2-5,15,17H,6-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | GVVVOOLVXKDQHU-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|