C19H27N3O5 — CID 44665836
2-(4-ethylpiperazin-4-ium-1-yl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone;2-hydroxy-2-oxoacetate (PubChem CID 44665836) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-4-ium-1-yl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone;2-hydroxy-2-oxoacetate.
| Compound Name | 2-(4-ethylpiperazin-4-ium-1-yl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44665836 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-(4-ethylpiperazin-4-ium-1-yl)-1-(2-methyl-2,3-dihydroindol-1-yl)ethanone;2-hydroxy-2-oxoacetate |
| SMILES | CC[NH+]1CCN(CC(=O)N2c3ccccc3CC2C)CC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C17H25N3O.C2H2O4/c1-3-18-8-10-19(11-9-18)13-17(21)20-14(2)12-15-6-4-5-7-16(15)20;3-1(4)2(5)6/h4-7,14H,3,8-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WKLLEOHEJSQEDO-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|