About CID 44666073
CID 44666073 (PubChem CID 44666073) has the molecular formula C32H28ClN3O4
and a molecular weight of 554.05 g/mol.
Molecular Properties
| Compound Name | CID 44666073 |
| PubChem CID | 44666073 |
| Molecular Formula | C32H28ClN3O4 |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | — |
| SMILES | C=CCOc1ccccc1C(=O)C1C2CCCN2C2(C(=O)Nc3c(C)cc(Cl)cc32)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C32H28ClN3O4/c1-3-15-40-25-13-7-4-9-20(25)28(37)26-24-12-8-14-36(24)32(22-17-19(33)16-18(2)27(22)35-30(32)39)31(26)21-10-5-6-11-23(21)34-29(31)38/h3-7,9-11,13,16-17,24,26H,1,8,12,14-15H2,2H3,(H,34,38)(H,35,39) |
| InChIKey | RURKFXVOKVQKIX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 44666073 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 44666073?
The IUPAC name of CID 44666073 (CID 44666073) is not available.
What is the SMILES notation for CID 44666073?
The canonical SMILES for CID 44666073 is C=CCOc1ccccc1C(=O)C1C2CCCN2C2(C(=O)Nc3c(C)cc(Cl)cc32)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 44666073?
The InChIKey is RURKFXVOKVQKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H28ClN3O4/c1-3-15-40-25-13-7-4-9-20(25)28(37)26-24-12-8-14-36(24)32(22-17-19(33)16-18(2)27(22)35-30(32)39)31(26)21-10-5-6-11-23(21)34-29(31)38/h3-7,9-11,13,16-17,24,26H,1,8,12,14-15H2,2H3,(H,34,38)(H,35,39).
What are the key properties of CID 44666073?
CID 44666073 has a molecular weight of 554.05 g/mol, XLogP of 5.23, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 44666073 is sourced from PubChem (CID 44666073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).