About CID 4967550
CID 4967550 (PubChem CID 4967550) has the molecular formula C31H24ClN3O4
and a molecular weight of 538.00 g/mol.
Molecular Properties
| Compound Name | CID 4967550 |
| PubChem CID | 4967550 |
| Molecular Formula | C31H24ClN3O4 |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | — |
| SMILES | Cc1cc(Cl)cc2c1NC(=O)C21N2CCCC2C(C(=O)c2cc3ccccc3o2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C31H24ClN3O4/c1-16-13-18(32)15-20-26(16)34-29(38)31(20)30(19-8-3-4-9-21(19)33-28(30)37)25(22-10-6-12-35(22)31)27(36)24-14-17-7-2-5-11-23(17)39-24/h2-5,7-9,11,13-15,22,25H,6,10,12H2,1H3,(H,33,37)(H,34,38) |
| InChIKey | UZSGWMDAKJOIFW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 4967550 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 4967550?
The IUPAC name of CID 4967550 (CID 4967550) is not available.
What is the SMILES notation for CID 4967550?
The canonical SMILES for CID 4967550 is Cc1cc(Cl)cc2c1NC(=O)C21N2CCCC2C(C(=O)c2cc3ccccc3o2)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 4967550?
The InChIKey is UZSGWMDAKJOIFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H24ClN3O4/c1-16-13-18(32)15-20-26(16)34-29(38)31(20)30(19-8-3-4-9-21(19)33-28(30)37)25(22-10-6-12-35(22)31)27(36)24-14-17-7-2-5-11-23(17)39-24/h2-5,7-9,11,13-15,22,25H,6,10,12H2,1H3,(H,33,37)(H,34,38).
What are the key properties of CID 4967550?
CID 4967550 has a molecular weight of 538.00 g/mol, XLogP of 5.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 4967550 is sourced from PubChem (CID 4967550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).