C16H22Cl2N4O — CID 44666494
[(2R)-3-methyl-1-oxo-1-[(2E)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]azanium;chloride;hydrochloride (PubChem CID 44666494) has the molecular formula C16H22Cl2N4O and a molecular weight of 357.29 g/mol. Its IUPAC name is [(2R)-3-methyl-1-oxo-1-[(2E)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]azanium;chloride;hydrochloride.
| Compound Name | [(2R)-3-methyl-1-oxo-1-[(2E)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]azanium;chloride;hydrochloride |
|---|---|
| PubChem CID | 44666494 |
| Molecular Formula | C16H22Cl2N4O |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [(2R)-3-methyl-1-oxo-1-[(2E)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]azanium;chloride;hydrochloride |
| SMILES | CCC(C)[C@@H]([NH3+])C(=O)N/N=C/c1cccc2cccnc12.Cl.[Cl-] |
| InChI | InChI=1S/C16H20N4O.2ClH/c1-3-11(2)14(17)16(21)20-19-10-13-7-4-6-12-8-5-9-18-15(12)13;;/h4-11,14H,3,17H2,1-2H3,(H,20,21);2*1H/b19-10+;;/t11?,14-;;/m1../s1 |
| InChIKey | JIPGJTILYMBNGC-AOGSRTEOSA-N |
| XLogP | -1.23 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|