C21H28N4O3 — CID 51553758
tert-butyl N-[(2R,3S)-3-methyl-1-oxo-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]carbamate (PubChem CID 51553758) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-3-methyl-1-oxo-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-3-methyl-1-oxo-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 51553758 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | tert-butyl N-[(2R,3S)-3-methyl-1-oxo-1-[(2Z)-2-(quinolin-8-ylmethylidene)hydrazinyl]pentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)OC(C)(C)C)C(=O)N/N=C\c1cccc2cccnc12 |
| InChI | InChI=1S/C21H28N4O3/c1-6-14(2)17(24-20(27)28-21(3,4)5)19(26)25-23-13-16-10-7-9-15-11-8-12-22-18(15)16/h7-14,17H,6H2,1-5H3,(H,24,27)(H,25,26)/b23-13-/t14-,17+/m0/s1 |
| InChIKey | JTLHNBSOIUFSSK-NQWCXVFWSA-N |
| XLogP | 3.62 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|