C19H22N2O3 — CID 47084216
methyl (2S,3S)-3-methyl-2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]pentanoate (PubChem CID 47084216) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl (2S,3S)-3-methyl-2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]pentanoate.
| Compound Name | methyl (2S,3S)-3-methyl-2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]pentanoate |
|---|---|
| PubChem CID | 47084216 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methyl (2S,3S)-3-methyl-2-[[(E)-3-quinolin-8-ylprop-2-enoyl]amino]pentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)/C=C/c1cccc2cccnc12)C(=O)OC |
| InChI | InChI=1S/C19H22N2O3/c1-4-13(2)17(19(23)24-3)21-16(22)11-10-15-8-5-7-14-9-6-12-20-18(14)15/h5-13,17H,4H2,1-3H3,(H,21,22)/b11-10+/t13-,17-/m0/s1 |
| InChIKey | UPZUVVMVPSVBER-UCRNMACNSA-N |
| XLogP | 2.95 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|