C18H21NO4 — CID 78832923
methyl 2-[3-(1-benzofuran-2-yl)prop-2-enoylamino]-3-methylpentanoate (PubChem CID 78832923) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is methyl 2-[3-(1-benzofuran-2-yl)prop-2-enoylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[3-(1-benzofuran-2-yl)prop-2-enoylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 78832923 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | methyl 2-[3-(1-benzofuran-2-yl)prop-2-enoylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)C=Cc1cc2ccccc2o1)C(=O)OC |
| InChI | InChI=1S/C18H21NO4/c1-4-12(2)17(18(21)22-3)19-16(20)10-9-14-11-13-7-5-6-8-15(13)23-14/h5-12,17H,4H2,1-3H3,(H,19,20) |
| InChIKey | NUZQPDTZLPVIIV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|