C29H40N2O7 — CID 44667652
(4R,8R,10R,14S)-5-[[(1-benzylpiperidin-4-yl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one;oxalic acid (PubChem CID 44667652) has the molecular formula C29H40N2O7 and a molecular weight of 528.65 g/mol. Its IUPAC name is (4R,8R,10R,14S)-5-[[(1-benzylpiperidin-4-yl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one;oxalic acid.
| Compound Name | (4R,8R,10R,14S)-5-[[(1-benzylpiperidin-4-yl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one;oxalic acid |
|---|---|
| PubChem CID | 44667652 |
| Molecular Formula | C29H40N2O7 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | (4R,8R,10R,14S)-5-[[(1-benzylpiperidin-4-yl)amino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one;oxalic acid |
| SMILES | CC1CCC[C@]2(C)C[C@H]3OC(=O)C(CNC4CCN(Cc5ccccc5)CC4)[C@H]3C3OC132.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H38N2O3.C2H2O4/c1-18-7-6-12-26(2)15-22-23(24-27(18,26)32-24)21(25(30)31-22)16-28-20-10-13-29(14-11-20)17-19-8-4-3-5-9-19;3-1(4)2(5)6/h3-5,8-9,18,20-24,28H,6-7,10-17H2,1-2H3;(H,3,4)(H,5,6)/t18?,21?,22-,23-,24?,26-,27?;/m1./s1 |
| InChIKey | GZDWZWFYGKFUCK-JEYATCHNSA-N |
| XLogP | 2.92 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|