C22H27NO2 — CID 44686
3-Hexanone, 4,4-diphenyl-6-morpholino- (PubChem CID 44686) has the molecular formula C22H27NO2 and a molecular weight of 337.50 g/mol. Its IUPAC name is 6-morpholin-4-yl-4,4-diphenylhexan-3-one.
| Compound Name | 3-Hexanone, 4,4-diphenyl-6-morpholino- |
|---|---|
| PubChem CID | 44686 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 6-morpholin-4-yl-4,4-diphenylhexan-3-one |
| SMILES | CCC(=O)C(CCN1CCOCC1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | InChI=1S/C22H27NO2/c1-2-21(24)22(19-9-5-3-6-10-19,20-11-7-4-8-12-20)13-14-23-15-17-25-18-16-23/h3-12H,2,13-18H2,1H3 |
| InChIKey | SXKOCXTXIUNMEN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | 386 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |