C24H32F3N3O13 — CID 44717733
N-[1,3-bis[[(2S,4S,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy]propan-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide (PubChem CID 44717733) has the molecular formula C24H32F3N3O13 and a molecular weight of 627.52 g/mol. Its IUPAC name is N-[1,3-bis[[(2S,4S,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy]propan-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide.
| Compound Name | N-[1,3-bis[[(2S,4S,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy]propan-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide |
|---|---|
| PubChem CID | 44717733 |
| Molecular Formula | C24H32F3N3O13 |
| Molecular Weight | 627.52 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | N-[1,3-bis[[(2S,4S,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy]propan-2-yl]-4-[3-(trifluoromethyl)diazirin-3-yl]benzamide |
| SMILES | O=C(NC(COC1[C@H](CO)OC(O)[C@H](O)[C@@H]1O)COC1[C@H](CO)OC(O)[C@H](O)[C@@H]1O)c1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C24H32F3N3O13/c25-24(26,27)23(29-30-23)10-3-1-9(2-4-10)20(37)28-11(7-40-18-12(5-31)42-21(38)16(35)14(18)33)8-41-19-13(6-32)43-22(39)17(36)15(19)34/h1-4,11-19,21-22,31-36,38-39H,5-8H2,(H,28,37)/t11?,12-,13-,14-,15-,16+,17+,18?,19?,21?,22?/m0/s1 |
| InChIKey | NPJHSWNPVIJJGQ-IWUSFQELSA-N |
| XLogP | -3.40 |
| TPSA | 252.58 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.52 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |