C10H15NO — CID 44718413
4,5-diethyl-3-methyl-1H-pyrrole-2-carbaldehyde (PubChem CID 44718413) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 4,5-diethyl-3-methyl-1H-pyrrole-2-carbaldehyde.
| Compound Name | 4,5-diethyl-3-methyl-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 44718413 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4,5-diethyl-3-methyl-1H-pyrrole-2-carbaldehyde |
| SMILES | CCc1[nH]c(C=O)c(C)c1CC |
| InChI | InChI=1S/C10H15NO/c1-4-8-7(3)10(6-12)11-9(8)5-2/h6,11H,4-5H2,1-3H3 |
| InChIKey | KZYGZAOSSXZJJO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|