C19H20N2O2 — CID 44722545
N-[(E)-2,3-dihydro-1H-inden-5-ylmethylideneamino]-4-ethoxybenzamide (PubChem CID 44722545) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(E)-2,3-dihydro-1H-inden-5-ylmethylideneamino]-4-ethoxybenzamide.
| Compound Name | N-[(E)-2,3-dihydro-1H-inden-5-ylmethylideneamino]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 44722545 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[(E)-2,3-dihydro-1H-inden-5-ylmethylideneamino]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C19H20N2O2/c1-2-23-18-10-8-16(9-11-18)19(22)21-20-13-14-6-7-15-4-3-5-17(15)12-14/h6-13H,2-5H2,1H3,(H,21,22)/b20-13+ |
| InChIKey | ZDZIFDVENUJOAP-DEDYPNTBSA-N |
| XLogP | 3.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|